| Identification | |
| Name: | Piperidine,2-(diphenylmethyl)-, hydrochloride (1:1) |
| Synonyms: | Piperidine,2-(diphenylmethyl)-, hydrochloride (6CI,8CI,9CI); 2-Diphenylmethylpiperidinehydrochloride |
| CAS: | 5807-81-8 |
| Molecular Formula: | C18H21 N . Cl H |
| Molecular Weight: | 287.827 |
| InChI: | InChI=1/C18H21N.ClH/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17;/h1-6,9-12,17-19H,7-8,13-14H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 287 ºC |
| Density: | g/cm3 |
| Specification: |
The 2-diphenylmethylpiperidine hydrochloride, with its CAS registry number 5807-81-8, has the molecular formula of C18H22ClN. As to its usage, it is usually applied in the pharmaceutic intermediates. The physical properties of this chemical are as below: (1)ACD/LogP: 4.46; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.37; (4)ACD/LogD (pH 7.4): 1.56; (5)#H bond acceptors: 1; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 3; (8)Polar Surface Area: 12.03; (9)Flash Point: 193.6 °C; (10)Enthalpy of Vaporization: 65.93 kJ/mol. In addition, you could convert the following datas into the molecular structure: |
| Safety Data | |
 |
|
