| Identification | |
| Name: | Idebenone |
| Synonyms: | 2,5-Cyclohexadiene-1,4-dione,2-(10-hydroxydecyl)- 5,6-dimethoxy-3-methyl-;Idebenone (JAN);2,5-Cyclohexadiene-1,4-dione, 5,6-dimethoxy-2-(10-hydroxydecyl)-3-methyl-;6-(10-Hydroxydecyl)-2,3-dimethoxy-5-methyl-1,4-benzoquinone;CV 2619;Idebenone [GMP];2-(10-Hydroxydecyl)-5,6-dimethoxy-3-methyl-p-benzoquinone;Idebenonum [Latin];Idebenone [INN:JAN];Idebenona [GMP];Idebenona [Spanish];2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl-cyclohexa-2,5-diene-1,4-dione;Idenbenone; |
| CAS: | 58186-27-9 |
| Molecular Formula: | C19H30O5 |
| Molecular Weight: | 338.44 |
| InChI: | InChI=1/C19H30O5/c1-14-15(12-10-8-6-4-5-7-9-11-13-20)17(22)19(24-3)18(23-2)16(14)21/h20H,4-13H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 52-550oC |
| Flash Point: | 170.1 oC |
| Boiling Point: | 497.3 oC at 760 mmHg |
| Density: | 1.08 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.502 |
| Solubility: | Insoluble |
| Appearance: | Yellow-orange crystalline powder |
| Specification: |
?Idebenone?(CAS NO.58186-27-9) is also called as?Idebenone [INN:JAN]?; 6-(10-Hydroxydecyl)-2,3-dimethoxy-5-methyl-1,4-benzoquinone ;?Idebenona ; Idebenona [Spanish] ; Idebenone ; Idebenonum ; Idebenonum [Latin] ;?2,5-Cyclohexadiene-1,4-dione, 2-(10-hydroxydecyl)-5,6-dimethoxy-3-methyl- ; 2,5-Cyclohexadiene-1,4-dione, 5,6-dimethoxy-2-(10-hydroxydecyl)-3-methyl- ; 2-(10-Hydroxydecyl)-5,6-dimethoxy-3-methyl-p-benzoquinone .It is an organic compound of the quinone family and promoted commercially as a synthetic analog of coenzyme Q10 (CoQ10). |
| Biological Activity: | Antioxidant and neuroprotective agent. Protects mitochondrial membranes against lipid peroxidation and blocks glutamate neurotoxicity in vitro and in vivo . Inhibits apoptosis of astrocytes via increased NGF production. |
| Flash Point: | 170.1 oC |
| Storage Temperature: | Room temp |
| Usage: | Ubiquinone derivative with protective effects against cerebral ischemia. Nootropic |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
