Identification |
Name: | 2-ethylhexyl (3-isocyanatomethylphenyl)-carbamate |
Synonyms: | Carbamic acid, (5-isocyanato-2(or 4)-methylphenyl)-, 2-ethylhexyl ester;(3-Isocyanatomethylphenyl)carbamic acid, 2-ethylhexyl ester;2-Ethylhexyl (3-isocyanatomethylphenyl)carbamate;2-Ethylhexyl(5-isocyanato-2(or 4)-methylphenyl)carbamate;Carbamic acid, (3-isocyanatomethylphenyl)-, 2-ethylhexyl ester;2-Ethylhexyl (3-isocyanatomethylphenyl)-carbamate |
CAS: | 58240-57-6 |
EINECS: | 261-180-6 |
Molecular Formula: | C17H24N2O3 |
Molecular Weight: | 304.3841 |
InChI: | InChI=1/C17H24N2O3/c1-3-5-7-14(4-2)12-22-17(21)19-16-9-6-8-15(10-16)11-18-13-20/h6,8-10,14H,3-5,7,11-12H2,1-2H3,(H,19,21) |
Molecular Structure: |
|
Properties |
Flash Point: | 185.4°C |
Boiling Point: | 382.9°C at 760 mmHg |
Density: | 1.06g/cm3 |
Refractive index: | 1.52 |
Specification: |
2-ethylhexyl (3-isocyanatomethylphenyl)-carbamate ,its cas register number is 58240-57-6. It also can be called (3-Isocyanatomethylphenyl)carbamic acid, 2-ethylhexyl ester ; 2-Ethylhexyl(5-isocyanato-2(or 4)-methylphenyl)carbamate ; and Toluenediisocyanate 2-ethylhexyl carbamate .
|
Flash Point: | 185.4°C |
Safety Data |
Hazard Symbols |
|
|
|