| Identification | ||
| Name: | 2-Mercaptobenzimidazole | |
| Synonyms: | Benzimidazole-2-thiol; Antioxidant MB; 1H-benzimidazol-2-yl hydrosulfide; 2-MERCAPTO BENZIMIDAZOLE; 1,3-dihydro-2h-benzimidazole-2-thion; 1,3-Dihydro-2H-benzimidazole-2-thione; 1,3-Dihydro-benzoimidazole-2-thione; 2,3-Dihydro-1H-benzimidazole-2-thiol; 2-Benzimidazolethione; 2-Benzimidazolinethione; 2-benzimidazolinthion; 2-Mercapto benzanidazole; MBI; 2- Mercaptobenzimidazole; 2H-Benzimidazole-2-thione, 1,3-dihydro-; 2H-Benzimidazole-2-thione,1,3-dihydro-; 2-Mercaptobenzoimidazole; 2-merkaptobenzimidazol; 2-Thiobenzimidazole; 2-Thiol benzimidazole; Anitiegene MB; Antiegene MB; antiegenemb; Antigen MB; Antigene MB; Zinc salt of 2-mercaptobenzimidazol | |
| CAS: | 583-39-1 | |
| EINECS: | 209-502-6 | |
| Molecular Formula: | C7H6N2S | |
| Molecular Weight: | 150.2 | |
| InChI: | InChI=1/C7H6N2S/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H2,8,9,10) | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | UN 2811 6.1/PG 3 | |
| Flash Point: | > 250 oC | |
| Stability: | Stable. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.714 | |
| Water Solubility: | <0.1 g/100 mL at 23.5 ºC | |
| Solubility: | <0.1 g/100 mL at 23.5 oC | |
| Appearance: | yellow or white crystals | |
| Specification: | yellow or white crystals usageEng:An antidegradant, protecting rubber from oxidation. An intermediate in the synthesis of Rabeprazole (R070500) Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Packinggroup: | III | |
| HS Code: | 29339910 | |
| Flash Point: | > 250 oC | |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. | |
| Usage: | An antidegradant, protecting rubber from oxidation. An intermediate in the synthesis of Rabeprazole (R070500) | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
