| Identification |
| Name: | 1,2-dibromobenzene |
| Synonyms: | o-dibromobenzene; o-bromochlorobenzene |
| CAS: | 583-53-9 |
| EINECS: | 209-507-3 |
| Molecular Formula: | C6H4Br2 |
| Molecular Weight: | 235.9 |
| InChI: | InChI=1/C6H4Br2/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2711 |
| Density: | 1.956 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.61-1.612 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | pale yellow liquid |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | brown-yellow |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
