| Identification |
| Name: | Benzene,1-bromo-2-iodo- |
| Synonyms: | 1-Iodo-2-bromobenzene;2-Bromo-1-iodobenzene;2-Bromoiodobenzene;2-Iodobromobenzene;o-Bromophenyl iodide;o-Iodobromobenzene; |
| CAS: | 583-55-1 |
| EINECS: | 209-508-9 |
| Molecular Formula: | C6H4BrI |
| Molecular Weight: | 282.91 |
| InChI: | InChI=1/C6H4BrI/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Density: | 2.203 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.662-1.664 |
| Solubility: | Insoluble |
| Appearance: | light yellow to red liquid |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
