| Identification | |
| Name: | 3-Pentanol |
| Synonyms: | Diethyl carbinol; Pentanol,98%; DIETHYLCARBINOL (3-PENTANOL); Pentan-3-ol; Pentanol-3; |
| CAS: | 584-02-1 |
| EINECS: | 209-526-7 |
| Molecular Formula: | C5H12O |
| Molecular Weight: | 88.15 |
| InChI: | InChI=1/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1105/2706 |
| Density: | 0.815 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.409-1.11 |
| Solubility: | 5.5 g/100 mL (30 ºC) |
| Appearance: | colourless liquid |
| Specification: |
Isoamyl alcohol (584-02-1),which also can be called for (C2H5)2CHOH ; 1-Ethyl-1-propanol ; 3-Pentyl alcohol ; 3-Pentylalcohol ; Alcool3-pentylique ; Diethylcarbinol(3-pentanol) ; Pentan-3-ol ; Pentanol(non-specificname) . Isoamyl alcohol (584-02-1) is viscous, colorless liquid with a characteristic,slightly pungent and penetrating odor. It's soluble in water.This chemical is stable under normal temperatures and pressures.After decomposition, Isoamyl alcohol (584-02-1) turned into Carbon monoxide ,irritating and toxic fumes and gases, Carbon dioxide .Take care of this chemical is flammable.When heated to decomposition it emits acrid smoke and irritating fumes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29051500 |
| Storage Temperature: | Flammables area |
| Usage: | Flotation agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
