| Identification | |
| Name: | 1-Bromo-3-nitrobenzene |
| CAS: | 585-79-5 |
| EINECS: | 209-563-9 |
| Molecular Formula: | C6H4BrNO2 |
| Molecular Weight: | 202.01 |
| InChI: | InChI=1/C6H4BrNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2732 |
| Density: | 1.7 |
| Solubility: | Soluble in alcohol, benzene and ether, insoluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder Safety Statements:36/37/39-26-22-45-37-28A-28-37/39 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37:Wear suitable gloves 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
