| Identification | |
| Name: | L-Alanine,3-(hydroxynitrosoamino)- |
| Synonyms: | Propionicacid, 2-amino-3-(hydroxynitrosamino)-, L- (8CI); Alanosine;L-2-Amino-3-(N-nitroso)hydroxylaminopropionic acid; L-2-Amino-3-(hydroxynitrosamino)propionicacid; L-Alanosine; NSC 153353; NSC 529469; SDX 102 |
| CAS: | 5854-93-3 |
| Molecular Formula: | C3H7 N3 O4 |
| Molecular Weight: | 149.13 |
| InChI: | InChI=1/C3H7N3O4/c4-2(3(7)8)1-6(10)5-9/h2,10H,1,4H2,(H,7,8)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 1900C (dec.) |
| Flash Point: | 175.7°C |
| Boiling Point: | 366.9°Cat760mmHg |
| Density: | 1.81g/cm3 |
| Refractive index: | 1.616 |
| Specification: |
1-Alanosine ,its CAS NO. is 5854-93-3,the synonyms is Alanosine ; 3-(Hydroxynitrosoamino)-l-alanine ; 2-Amino-3-(n-hydroxy-n-nitrosamino)-propionicacid ; l-2-Amino-3-(n-nitroso)hydroxylaminopropionic acid ; NSC 153353 ; NSC 529469 ; SDX 102 . |
| Flash Point: | 175.7°C |
| Usage: |
Antibiotic substance from the fermentation of Streptomyces alanosinicus. The first natural product found to have a N-nitrosohydroxylamino group on an aliphatic chain. An experimental insect reproduction inhibitor. |
| Safety Data | |
 |
|
