| Identification | |
| Name: | 3-Hydroxy-4-methylbenzoic acid |
| Synonyms: | 3-Hydroxy-p-toluic acid |
| CAS: | 586-30-1 |
| EINECS: | 209-571-2 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.14732 |
| InChI: | InChI=1S/C8H8O3/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,9H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 181.2 ºC |
| Boiling Point: | 352.6 ºC at 760 mmHg |
| Density: | 1.304 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.599 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | White to yellowish crystalline powder |
| Specification: | white to slightly beige powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29182990 |
| Flash Point: | 181.2 ºC |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
