| Identification | |
| Name: | 4-Acetylbenzoic acid |
| Synonyms: | Benzoicacid, p-acetyl- (6CI,7CI,8CI);4-(1-Oxoethyl)benzoic acid;4-Carboxyacetophenone;NSC 16644;p-Acetylbenzoic acid;p-Carboxyacetophenone;Benzoicacid, 4-acetyl-; |
| CAS: | 586-89-0 |
| EINECS: | 209-588-5 |
| Molecular Formula: | C9H8O3 |
| Molecular Weight: | 164.16 |
| InChI: | InChI=1/C9H8O3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.229 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | white to light yellow crystal powder |
| Specification: |
4-Acetylbenzoic acid (CAS NO.586-89-0) is also named as benzoic acid, 4-acetyl- ; 4-Acetyl-benzoic acid ; 4'-Carboxyacetohenone ; Acetophenone-4'-carboxylic acid ; Acetophenone-4-carboxylic acid . 4-Acetylbenzoic acid (CAS NO.586-89-0) is white to light yellow crystal powder. |
| HS Code: | 29183000 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
