| Identification | |
| Name: | 2-Amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| CAS: | 587-45-1 |
| Molecular Formula: | C9H11NO4 |
| Molecular Weight: | 197.18794 |
| InChI: | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 284-286 deg C |
| Solubility: | Readily sol in dil hydrochloric and formic acids; practically insol in ethanol, benzene, chloroform, ethyl acetate In water, 5,000 mg/l @ 20 deg C |
| Color: | Colorless to white crystals or crystalline powder; needles from water |
| Safety Data | |
 |
|
