| Identification | |
| Name: | Urea,N,N'-bis(4-nitrophenyl)- |
| Synonyms: | Carbanilide,4,4'-dinitro- (6CI,7CI,8CI);1,3-Bis(4-nitrophenyl)urea;1,3-Di(4-nitrophenyl)urea;4,4'-Dinitrocarbanilide;4,4'-Dinitrodiphenylurea;DNC;N,N'-Bis(4-nitrophenyl)urea;N,N'-Bis(p-nitrophenyl)urea;N,N'-Di(p-nitrophenyl)urea;NSC 101086; |
| CAS: | 587-90-6 |
| EINECS: | 209-607-7 |
| Molecular Formula: | C13H10N4O5 |
| Molecular Weight: | 302.24 |
| InChI: | InChI=1/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.561 g/cm3 |
| Refractive index: | 1.741 |
| Specification: | Yellow Solid usageEng:The active component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Refrigerator |
| Usage: | The active component of the antifertility agent nicarbazin, in chicken, duck, and goose plasma. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
