| Identification | |
| Name: | Benzenamine,N,N-dimethyl-, hydrochloride (1:1) |
| Synonyms: | Aniline,N,N-dimethyl-, hydrochloride (8CI);Benzenamine, N,N-dimethyl-, hydrochloride(9CI);Dimethylaniline hydrochloride;Dimethylphenylammonium chloride;N,N-Dimethylaniline hydrochloride;N,N-Dimethylanilinium hydrochloride; |
| CAS: | 5882-44-0 |
| EINECS: | 227-555-3 |
| Molecular Formula: | C8H12ClN |
| Molecular Weight: | 157.64 |
| InChI: | InChI=1/C8H11N.ClH/c1-9(2)8-6-4-3-5-7-8;/h3-7H,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 2.50 deg C |
| Flash Point: | 62.8°C |
| Boiling Point: | 193.5°Cat760mmHg |
| Density: | 0.95g/cm3 |
| Solubility: | Freely sol in alcohol, chloroform, ether Sol in acetone, benzene, org solvents Sol in oxygenated and chlorinated solvents Soluble in ethanol, ethyl ether, and acetone Water solubility of 1454 ppm at 25 deg C |
| Flash Point: | 62.8°C |
| Color: | Pale-yellow, oily liquid [Note: A solid below 36 degrees F]. Yellowish to brownish, oily liquid |
| Safety Data | |
 |
|
