| Identification | |
| Name: | N,4-Dimethyl-1,2,5-oxadiazole-3-methanamine |
| Synonyms: | N-methyl-1-(4-methyl-1,2,5-oxadiazol-3-yl)methanamine;1,2,5-Oxadiazole-3-methanamine, N,4-dimethyl-;Methyl-(4-methyl-furazan-3-ylmethyl)-amine;N-Methyl-1-(4-methyl-1,2,5-oxadiazol-3-yl)methanamine; |
| CAS: | 588730-16-9 |
| Molecular Formula: | C5H9N3O |
| Molecular Weight: | 127.14 |
| InChI: | InChI=1/C5H9N3O/c1-4-5(3-6-2)8-9-7-4/h6H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.09 g/cm3 |
| Refractive index: | 1.472 |
| Specification: |
The N,4-Dimethyl-1,2,5-oxadiazole-3-methanamine with the cas number 588730-16-9, is also called N-methyl-1-(4-methyl-1,2,5-oxadiazol-3-yl)methanamine .The properties of this chemical are: (1)#H bond acceptors: 4 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 2 ; (4)Polar Surface Area: 42.16 Å2 ; (5)Index of Refraction: 1.472 ; (6)Molar Refractivity: 32.7 cm3 ; (7)Molar Volume: 116.5 cm3 ; (8)Polarizability: 12.96×10-24cm3 ; (9)Surface Tension: 39.2 dyne/cm ; (10)Enthalpy of Vaporization: 42.11 kJ/mol ; (11)Vapour Pressure: 0.719 mmHg at 25°C. This product can be supplied by the following supplier: (1)Shanghai Eshine Chemicals Co., Ltd.; (2)Chem-Impex International, Inc.; (3)Anichem LLC; (4)J & W PharmLab, LLC; (5)Chemical Block Ltd.; (6)TimTec Corporation; (7)Syntask Laboratories, Inc.; (8)Princeton BioMolecular Research, Inc.. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
