Identification |
Name: | Benzoic acid,4-[bis(2-hydroxypropyl)amino]-, ethyl ester |
Synonyms: | AmerscreenP; Ethyl dihydroxypropyl PABA; Roxadimate |
CAS: | 58882-17-0 |
EINECS: | 261-482-8 |
Molecular Formula: | C15H23 N O4 |
Molecular Weight: | 281.35 |
InChI: | InChI=1/C15H23NO4/c1-4-20-15(19)13-5-7-14(8-6-13)16(9-11(2)17)10-12(3)18/h5-8,11-12,17-18H,4,9-10H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 225.9°C |
Boiling Point: | 450°C at 760 mmHg |
Density: | 1.154g/cm3 |
Refractive index: | 1.557 |
Specification: | Thick Yellow Oil usageEng:Used to reduce skin mutation and DNA damage |
Flash Point: | 225.9°C |
Usage: | Used to reduce skin mutation and DNA damage |
Safety Data |
|
 |