Identification |
Name: | Butanoic acid,3-methyl-, 2-methylpropyl ester |
Synonyms: | Isovalericacid, isobutyl ester (6CI,7CI,8CI);2-Methylpropyl 3-methylbutanoate;2-Methylpropyl 3-methylbutyrate;2-Methylpropyl isovalerate;Isobutyl3-methylbutanoate;Isobutyl 3-methylbutyrate;Isobutyl isopentanoate;NSC 6993; |
CAS: | 589-59-3 |
EINECS: | 209-653-8 |
Molecular Formula: | C9H18O2 |
Molecular Weight: | 158.24 |
InChI: | InChI=1/C9H18O2/c1-7(2)5-9(10)11-6-8(3)4/h7-8H,5-6H2,1-4H3 |
Molecular Structure: |
|
Properties |
Density: | 0.853 |
Refractive index: | 1.406 |
Solubility: | Insoluble |
Storage Temperature: | Keep tightly closed. Keep away from heat and open flame. Store in a cool dry place. |
Usage: | Flavoring and production of fruit essences. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|