| Identification | |
| Name: | 3-Heptanol |
| CAS: | 589-82-2 |
| EINECS: | 209-661-1 |
| Molecular Formula: | C7H16 O |
| Molecular Weight: | 116.20134 |
| InChI: | InChI=1S/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1987 3 |
| Melting Point: | -70 |
| Refractive index: | n20/D 1.421(lit.) |
| Water Solubility: | insoluble in water; soluble in alcohol |
| Solubility: | insoluble in water; soluble in alcohol |
| Appearance: | colourless oily liquid with a powerful, herbaceous odour |
| Specification: |
3-Heptanol (589-82-2) is also known as 3-Hydroxyheptane ; 4-01-00-01741 (Beilstein Handbook Reference) ; AI3-21994 ; Butyl ethyl carbinol ; Ethyl butyl carbinol ; FEMA No. 3547 ; NSC 2586 . 3-Heptanol (589-82-2) is mainly used as organic solvent and paint thinner. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | Z01 |
| Safety Data | |
| Hazard Symbols | |
 |
|
