| Identification | |
| Name: | 3-Octanol |
| Synonyms: | 1-Ethyl-1-hexanol;DL-3-Octanol;Ethylamylcarbinol;Octan-3-ol;n-Octan-3-ol; |
| CAS: | 589-98-0 |
| EINECS: | 209-667-4 |
| Molecular Formula: | C8H18O |
| Molecular Weight: | 130.22792 |
| InChI: | InChI=1S/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.825 |
| Refractive index: | n20/D 1.426(lit.) |
| Water Solubility: | 1.252 g is soluble in 1 kg. of water . |
| Solubility: | 1.252 g is soluble in 1 kg. of water . |
| Appearance: | Colourless, clear Liquid |
| Specification: | Clear colorless liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
