| Identification | |
| Name: | Tetrahydro-2-methyl-3-thioxo-1,2,4-triazine-5,6-dione |
| Synonyms: | 2,5-Dihydro-6-Hydroxy-3-Mercapto-2-Methyl-5-oxo-1,2,4-Triazine ( TTZ , Thiotriazinone );2-Methyl-5,6-dioxo-1,2,5,6-tetrahydro-1,2,4-triazine-3-thiol; |
| CAS: | 58909-39-0 |
| EINECS: | 261-490-1 |
| Molecular Formula: | C4H5N3O2S |
| Molecular Weight: | 159.17 |
| InChI: | InChI=1/C4H5N3O2S/c1-7-4(10)5-2(8)3(9)6-7/h1H3,(H,6,9)(H,5,8,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 118ºC |
| Boiling Point: | 272ºC |
| Density: | 1.62 g/cm3 |
| Refractive index: | 1.678 |
| Appearance: | white powder |
| Specification: | White Solid usageEng:Reagent used in the preparation of Cefalosporins. Safety Statements:36 36:Wear suitable protective clothing |
| Flash Point: | 118ºC |
| Storage Temperature: | Refrigerator |
| Usage: | Reagent used in the preparation of Cefalosporins. |
| Safety Data | |
 |
|
