| Identification |
| Name: | Hexanedioic acid, ester with 2,2-oxybis(ethanol) |
| Synonyms: | Hexanedioic acid, ester with 2,2'-oxybis[ethanol] |
| CAS: | 58984-19-3 |
| EINECS: | 261-541-8 |
| Molecular Formula: | C10H18O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H18O6/c11-5-6-15-7-8-16-10(14)4-2-1-3-9(12)13/h11H,1-8H2,(H,12,13) |
| Molecular Structure: |
![(C10H18O6) Hexanedioic acid, ester with 2,2'-oxybis[ethanol]](https://img.guidechem.com/cas/gif/58984-19-3.gif) |
| Properties |
| Flash Point: | 158.5°C |
| Boiling Point: | 412.9°C at 760 mmHg |
| Density: | 1.197g/cm3 |
| Refractive index: | 1.474 |
| Flash Point: | 158.5°C |
| Safety Data |
| |
 |