| Identification | |
| Name: | Ethopabate |
| Synonyms: | Benzoicacid, 4-(acetylamino)-2-ethoxy-, methyl ester; |
| CAS: | 59-06-3 |
| EINECS: | 200-414-3 |
| Molecular Formula: | C12H15NO4 |
| Molecular Weight: | 237.25 |
| InChI: | InChI=1/C12H15NO4/c1-4-17-11-7-9(13-8(2)14)5-6-10(11)12(15)16-3/h5-7H,4H2,1-3H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.18 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.545 |
| Solubility: | 0.17 g/L (25 C) |
| Appearance: | White powder |
| Specification: |
Ethopabate , its cas register number is 59-06-3. It also can be called Ethopabat ; 4-Acetamido-2-ethoxybenzoesaeuremethylester ; and Methyl 4-acetamido-2-ethoxybenzoate . |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
