| Identification |
| Name: | Thiamine chloride |
| Synonyms: | VB1;Thiamine(8CI);Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl-chloride (9CI);Aneurine;Apatate Drape;Beivon;Bethiamin;Oryzanin;Thiacoat;Thiamin;Thiamine monochloride;Vitamin B1;Vitaneurin;thiamine;3-[(4-Amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium chloride; |
| CAS: | 59-43-8 |
| EINECS: | 200-425-3 |
| Molecular Formula: | C12H17ClN4OS |
| Molecular Weight: | 300.81 |
| InChI: | InChI=1/C12H17N4OS.ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);1H/q+1;/p-1 |
| Molecular Structure: |
![(C12H17ClN4OS) VB1;Thiamine(8CI);Thiazolium, 3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methyl...](https://img.guidechem.com/casimg/59-43-8.gif) |
| Properties |
| Melting Point: | 128 - 129 |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Slightly soluble. |
| Appearance: | Small white to yellowish crystals or crystalline powder |
| Specification: |
???Thiamine chloride (CAS No.59-43-8), its synonyms are Vitamin B1 ; 3-((4-Amino-2-methyl-5-pyrimidinyl)methyl)-5-(2- hydroxyethyl)-4-methylthiazolium chloride ; Thiazolium, 3-((4-amino-2-methyl-5-pyrimidinyl)methyl)-5-(2-hydroxyethyl)-4-methyl-chloride? .
|
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Crystals from water |
| Usage: | Prevention and treatment of vitamin b1 deficiency. |
| Safety Data |
| |
 |