| Identification | |
| Name: | DL-Methionine |
| Synonyms: | Methilonin;Methionine, amorphous;Methionine, DL-;Hmet;Meonine;DL-Methioninum;Pedameth;2-amino-4-(methylsulfanyl)butanoic acid;(2S)-2-azaniumyl-4-methylsulfanyl-butanoate;(2R)-2-azaniumyl-4-methylsulfanyl-butanoate;Urimeth;Metione;2-amino-4-(methylthio)butanoic acid;Cynaron;Dyprin;Lobamine;(+-)-Methionine;Racemethionine [USAN];Neston;alpha-Amino-gamma-(methylthio)butyric acid;DL-2-Amino-4-(methylthio)-butyric acid;Acimetion;Banthionine;alpha-amino-gamma-methylmercaptobutyric acid;DL-2-Amino-4-(methylthio)butanoic acid;DL-2-Amino-4-methylthiobutyric acid;H-DL-Met-OH;Racemethionine; |
| CAS: | 59-51-8 |
| EINECS: | 200-432-1 |
| Molecular Formula: | C5H11NO2S |
| Molecular Weight: | 149.21 |
| InChI: | InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.34 |
| Stability: | Stable. Incompatible with strong oxidising agents. |
| Appearance: | white crystalline powder with a faint odor |
| Specification: |
?Racemethionine , its cas register number is 59-51-8. It also can be called?(+-)-Methionine ; Acimetion ; Banthionine ; Cynaron ; DL-2-Amino-4-(methylthio)-butyric acid ; DL-Methioninum ; Dyprin ; Lobamine ; alpha-Amino-gamma-(methylthio)butyric acid ; alpha-Amino-gamma-methylmercaptobutyric acid ; alpha-Amino-gamma-methylmercaptobutyric acid (VAN)?.It is a?white crystalline powder with a faint odor. |
| HS Code: | 29304090 |
| Color: | Minute hexagonal plates from dilute alcohol Colorless or white, lustrous plates or as white, crystalline powder |
| Usage: | One of the 20 common amino acids. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
