| Identification | |
| Name: | Potassium sorbate |
| Synonyms: | EPA Pesticide Chemical Code 075902;Sorbic acid, potassium salt;Potassium 2,4-hexadienoate;Sorbistat-potassium;BB Powder;Sorbistat-K;2,4-Hexadienoic acid, potassium salt;FEMA No. 2921;Potassium Sorbate Granular; |
| CAS: | 590-00-1 |
| EINECS: | 246-376-1 |
| Molecular Formula: | C6H7KO2 |
| Molecular Weight: | 150.21688 |
| InChI: | InChI=1S/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.363 g/cm3 (25 C) |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | White to beige powder. |
| Specification: |
?Potassium sorbate , its cas register number is 590-00-1. It also can be called 2,4-Hexadienoic acid potassium salt ; and Sorbic acid, potassium salt . |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | WHITE CRYSTALS OR POWDER |
| Usage: | As mold & yeast inhibitor. |
| Safety Data | |
 |
|
