| Identification | |
| Name: | Methanol, 1-bromo-,1-acetate |
| Synonyms: | Methanol,bromo-, acetate (6CI,7CI,9CI);Acetoxymethyl bromide;Acetyloxymethyl bromide;Bromomethyl acetate; |
| CAS: | 590-97-6 |
| EINECS: | 209-696-2 |
| Molecular Formula: | C3H5BrO2 |
| Molecular Weight: | 152.975 |
| InChI: | InChI=1/C3H5BrO2/c1-3(5)6-2-4/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3272 |
| Flash Point: | 59 ºC |
| Boiling Point: | 132.7 ºC at 760 mmHg |
| Density: | 1.614 g/cm3 |
| Refractive index: | 1.447 |
| Specification: | Clear colorless to yellow liquid usageEng:Has cytotoxicity and mutagenicity effects. Safety Statements:26-36-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 59 ºC |
| Storage Temperature: | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |
| Usage: | Has cytotoxicity and mutagenicity effects. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
