| Identification | |
| Name: | b-D-Glucopyranoside, hexyl |
| Synonyms: | 1-Hexylb-D-glucoside; Hexyl glucoside;Hexyl b-D-glucopyranoside; n-Hexyl b-D-glucopyranoside; n-Hexyl-b-D-glucoside |
| CAS: | 59080-45-4 |
| Molecular Formula: | C12H24 O6 |
| Molecular Weight: | 264.3154 |
| InChI: | InChI=1/C12H24O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h8-16H,2-7H2,1H3/t8-,9-,10+,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 215.2ºC |
| Boiling Point: | 432.3ºC at 760 mmHg |
| Density: | 1.23 g/cm3 |
| Refractive index: | 1.521 |
| Specification: | White Crystalline Solid usageEng:A mild nonionic detergent Safety Statements:22-24/25-36/37/39-27-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29389090 |
| Flash Point: | 215.2ºC |
| Storage Temperature: | 2-8°C |
| Usage: |
Hexyl-beta-D-glucopyranoside (CAS NO.59080-45-4) is used as a mild nonionic detergent. |
| Safety Data | |
 |
|
