| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 2,3-dihydroxypropyl ester |
| Synonyms: | Methacrylicacid, 2,3-dihydroxypropyl ester (6CI);Methacrylin, 1-mono- (8CI);2,3-Dihydroxypropyl methacrylate;Glyceryl methacrylate; |
| CAS: | 5919-74-4 |
| EINECS: | 227-642-6 |
| Molecular Formula: | C7H12O4 |
| Molecular Weight: | 160.17 |
| InChI: | InChI=1/C7H12O4/c1-5(2)7(10)11-4-6(9)3-8/h6,8-9H,1,3-4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 127.3°C |
| Boiling Point: | 140°C 0,6mm |
| Density: | 1.161g/cm3 |
| Refractive index: | 1.475 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 127.3°C |
| Safety Data | |
 |
|
