| Identification |
| Name: | Laurocapram |
| Synonyms: | Laurocapramum;1-Dodecylazepan-2-one;2H-Azepin-2-one,1-dodecylhexahydro-;1-Dodecylazacycloheptan-2-one;2H-Azepin-2-one, 1-dodecylhexahydro-;N-Lauryl caprolactam;N 0252;Tranzone;1-Dodecyl azacyclohepta-2-one;N-Dodecylcaprolactam;Laurocapram Azone; |
| CAS: | 59227-89-3 |
| EINECS: | 261-668-9 |
| Molecular Formula: | C18H35NO |
| Molecular Weight: | 281.4766 |
| InChI: | InChI=1S/C18H35NO/c1-2-3-4-5-6-7-8-9-10-13-16-19-17-14-11-12-15-18(19)20/h2-17H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -7 deg C |
| Boiling Point: | 350 |
| Density: | 0.906-0.926 |
| Refractive index: | 1.470-1.473 |
| Water Solubility: | Insoluble in water, and form emulsions with water, soluble in various organic solvents. |
| Solubility: | Insoluble in water, and form emulsions with water, soluble in various organic solvents. |
| Appearance: | Colorless or yellowish transparent liquid |
| Color: | Clear, colorless liquid |
| Safety Data |
| |
 |
