| Identification |
| Name: | (-)-Menthyl lactate |
| Synonyms: | Propanoicacid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-[1a(R*),2b,5a]]-;l-Menthyl D-lactate;Propanoic acid,2-hydroxy-, (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl ester, (2R)-; |
| CAS: | 59259-38-0 |
| EINECS: | 261-678-3 |
| Molecular Formula: | C13H24O3 |
| Molecular Weight: | 228.33 |
| InChI: | InChI=1/C13H24O3/c1-8(2)11-6-5-9(3)7-12(11)16-13(15)10(4)14/h8-12,14H,5-7H2,1-4H3/t9-,10-,11+,12-/m1/s1 |
| Molecular Structure: |
![(C13H24O3) Propanoicacid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, [1R-[1a(R*),2b,5a]]-;l-Menthy...](https://img.guidechem.com/structureimg/59259-38-0.gif) |
| Properties |
| Boiling Point: | 80 - 85 (1 torr) |
| Density: | 0.99g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -74 o (C=10, ETOH) |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble in water |
| Appearance: | White solid with a faintly minty odor. |
| Specification: |
(-)-Menthyl lactate (CAS NO.59259-38-0) is also named as 5-Methyl-2-(1-methylethyl)cyclohexyl 2-hydroxypropanoate, (1R-(1alpha(R*),2beta,5alpha))- ; 5-Methyl-2-(1-methylethyl)cyclohexyl alpha-hydroxypropanoate ; FEMA No. 3748 ; Frescolat ; Menthan-3-yl lactate, (-)-p- ; Propanoic acid, 2-hydroxy-, 5-methyl-2-(1-methylethyl)cyclohexyl ester, (1R-(1alpha(R*),2beta,5alpha))- ; l-Menthyl lactate . (-)-Menthyl lactate (CAS NO.59259-38-0) is white to light yellow crystal powder.
|
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Cooling material that leaves the skin feeling refreshed and tingling. |
| Safety Data |
| |
 |