| Identification | |
| Name: | 3-Hexadecanol |
| Synonyms: | Hexadecan-3-ol; |
| CAS: | 593-03-3 |
| EINECS: | 209-781-4 |
| Molecular Formula: | C16H34O |
| Molecular Weight: | 242.44 |
| InChI: | InChI=1/C16H34O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)4-2/h16-17H,3-15H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.834 g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.576 (99.6 C) |
| Solubility: | Insoluble |
| Specification: |
3-Hexadecanol , its cas register number is . It also can be called Hexadecan-3-ol . |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data | |
 |
|
