| Identification | |
| Name: | Guanidine thiocyanate |
| Synonyms: | Guanidine isothiocyanate; Guanidinium Isothiocyanate; Thiocyanic acid, compd. with guanidine (1:1); |
| CAS: | 593-84-0 |
| EINECS: | 209-812-1 |
| Molecular Formula: | C2H6N4S;CH5N3?HSCN |
| Molecular Weight: | 118.16084 |
| InChI: | InChI=1S/CH5N3.CHNS/c2-1(3)4;2-1-3/h(H5,2,3,4);3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Stability: | Stability Stable, but light sensitive. Incompatible with acids (contact releases very toxic gas), strong oxidising agents. |
| Refractive index: | n20/D 1.482 |
| Appearance: | white powder |
| Specification: | White cryst.powder Safety Statements:36/37-61-13-36-26 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet 13:Keep away from food, drink and animal feeding stuffs 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| HS Code: | 29252000 |
| Storage Temperature: | Store at RT. |
| Usage: | A powerful chaotropic agent. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
