| Identification |
| Name: | Thallium,tribromo(cyclohexanone)-, (T-4)- |
| Synonyms: | Cyclohexanone,compd. with TlBr3 (7CI); Cyclohexanone, thallium complex; Thallium bromide,TlBr3, compd. with cyclohexanone (1:1) |
| CAS: | 5930-13-2 |
| Molecular Formula: | C6H10 Br3 O Tl |
| Molecular Weight: | 238.3012 |
| InChI: | InChI=1/C13H19FN2O/c1-10(9-16(2)3)8-15-13(17)11-4-6-12(14)7-5-11/h4-7,10H,8-9H2,1-3H3,(H,15,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 170.9°C |
| Boiling Point: | 359°C at 760 mmHg |
| Density: | 1.063g/cm3 |
| Refractive index: | 1.507 |
| Flash Point: | 170.9°C |
| Safety Data |
| |
 |
