| Identification | |
| Name: | Phenol,4-amino-2,6-dichloro- |
| Synonyms: | 2,6-Dichloro-4-aminophenol;2,6-Dichloro-p-aminophenol;3,5-Dichloro-4-hydroxyaniline;4-Amino-2,6-dichlorophenol;4-Hydroxy-3,5-dichloroaniline;NSC 156835; |
| CAS: | 5930-28-9 |
| EINECS: | 227-671-4 |
| Molecular Formula: | C6H5Cl2NO |
| Molecular Weight: | 178.02 |
| InChI: | InChI=1/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.4 ºC |
| Boiling Point: | 303.6 ºC at 760 mmHg |
| Density: | 1.56 g/cm3 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| Solubility: | Slightly soluble |
| Appearance: | solid |
| Specification: |
Phenol,4-amino-2,6-dichloro- with cas registry number of 5930-28-9 is also called 4-Amino-2,6-dichlorophenol ; 2,6-Dichloro-4-aminophenol ; 2,6-Dichloro-p-aminophenol ; 3,5-Dichloro-4-hydroxyaniline ; 4-Amino-2,6-dichlorophenol ; NSC 156835 . |
| Packinggroup: | I; II; III |
| Flash Point: | 137.4 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
