| Identification | |
| Name: | Trimethylphosphine |
| Synonyms: | Trimethylphosphine solution; Trimethylphosphineminampouled; TrimethylphosphineSureSealbottlecolorlessliquid |
| CAS: | 594-09-2 |
| EINECS: | 209-823-1 |
| Molecular Formula: | C3H9P |
| Molecular Weight: | 76.08 |
| InChI: | InChI=1/C3H9P/c1-4(2)3/h1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | -22? |
| Density: | 0.738 |
| Refractive index: | 1.428 |
| Solubility: | Soluble |
| Appearance: | Colorless liquid with a strong, unpleasant odor. |
| Specification: |
Trimethylphosphine is the chemical compound with the formula P(CH3)3, commonly abbreviated PMe3. This colorless liquid has a strongly unpleasant odour, which is characteristic of alkylphosphines. It is a pyramidal molecule with C3v symmetry, similar to ammonia (NH3) and phosphine(PH3). As a ligand, its cone angle is 118°. |
| Packinggroup: | I |
| Flash Point: | -22? |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air & Moisture Sensitive |
| Usage: | Ligand in coordination chemistry. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
Xi:Irritant
|
 |
|
