Identification |
Name: | Carbamimidothioic acid,(10-methyl-9-anthracenyl)methyl ester, hydrochloride (1:1) |
Synonyms: | Carbamimidothioicacid, (10-methyl-9-anthracenyl)methyl ester, monohydrochloride (9CI); NSC146109 |
CAS: | 59474-01-0 |
Molecular Formula: | C17H16 N2 S . Cl H |
Molecular Weight: | 316.85 |
InChI: | InChI=1/C17H16N2S/c1-11-12-6-2-4-8-14(12)16(10-20-17(18)19)15-9-5-3-7-13(11)15/h2-9H,10H2,1H3,(H3,18,19) |
Molecular Structure: |
|
Properties |
Flash Point: | 252.3°C |
Boiling Point: | 493.6°C at 760 mmHg |
Density: | 1.23g/cm3 |
Refractive index: | 1.665 |
Biological Activity: | Cell-permeable, genotype-selective antitumor agent that activates p53-dependent transcription. Increases levels of endogenous p53 in tumor cells and protects p53 from Mdm2-mediated degradation. Displays some selectivity for tumor cells vs. normal cells in an MTT cell viability assay. |
Flash Point: | 252.3°C |
Storage Temperature: | Desiccate at RT |
Safety Data |
|
|