| Identification |
| Name: | Cobalt,diaqua[ethanedioato(2-)-kO1,kO2]-, (T-4)- |
| Synonyms: | Cobalt,diaqua[ethanedioato(2-)-O,O']-, (T-4)-;Oxalic acid, cobalt(2+) salt (1:1),dihydrate (8CI);Cobalt oxalate (1:1), dihydrate;Cobalt oxalate (CoC2O4)dihydrate;Cobalt oxalate, dihydrate;Cobalt(2+) oxalate dihydrate;Cobaltousoxalate (1:1) dihydrate;Cobaltous oxalate dihydrate; |
| CAS: | 5965-38-8 |
| EINECS: | 212-409-3 |
| Molecular Formula: | C2H4CoO6 |
| Molecular Weight: | 352.79272 |
| InChI: | InChI=1S/C15H13ClN2O4S/c1-3-4-18-14(21)9(13(20)17-15(18)23)5-8-6-10(16)12(19)11(7-8)22-2/h3,5-7,19H,1,4H2,2H3,(H,17,20,23)/b9-5- |
| Molecular Structure: |
![(C2H4CoO6) Cobalt,diaqua[ethanedioato(2-)-O,O']-, (T-4)-;Oxalic acid, cobalt(2+) salt (1:1),dihydrate (8CI);Cob...](https://img.guidechem.com/casimg/5965-38-8.gif) |
| Properties |
| Transport: | UN3288 |
| Density: | 3.021 |
| Refractive index: | 1.682 |
| Water Solubility: | soluble in ammonia,slightly soluble in water and acid |
| Solubility: | soluble in ammonia,slightly soluble in water and acid |
| Appearance: | Light pink crystals |
| Packinggroup: | III |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |