| Identification | |
| Name: | 2-Piperazinone,1-methyl- |
| Synonyms: | Piperazinone,1-methyl- (9CI);1-Methylpiperazin-2-one;4-Methyl-3-oxopiperazine; |
| CAS: | 59702-07-7 |
| Molecular Formula: | C5H10N2O |
| Molecular Weight: | 114.15 |
| InChI: | InChI=1/C5H10N2O/c1-7-3-2-6-4-5(7)8/h6H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.037 g/cm3 |
| Refractive index: | 1.461 |
| Specification: |
The cas register number of 1-Methylpiperazin-2-one is 59702-07-7. It also can be called as 2-Piperazinone,1-methyl- and the IUPAC Name about this chemical is 1-methylpiperazin-2-one. Physical properties about 1-Methylpiperazin-2-one are: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 1; (4)ACD/KOC (pH 7.4): 2.745; (5)#H bond acceptors: 3; (6)#H bond donors: 1; (7)Polar Surface Area: 32.34Å2; (8)Index of Refraction: 1.461; (9)Molar Refractivity: 30.2 cm3; (10)Molar Volume: 110.039 cm3; (11)Polarizability: 11.972x10-24cm3; (12)Surface Tension: 31.343 dyne/cm; (13)Enthalpy of Vaporization: 47.909 kJ/mol; (14)Boiling Point: 242.12 °C at 760 mmHg; (15)Vapour Pressure: 0.035 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
