Identification |
Name: | Toluene sulfonyl chloride |
Synonyms: | Ethylamine,N,N-dimethyl- (6CI,7CI,8CI); DMEA; Dimethylethylamine; Methanamine,N-ethyl-N-methyl-; N,N-Dimethylaminoethane; N,N-Dimethylethanamine;N,N-Dimethylethylamine; N-Ethyldimethylamine |
CAS: | 598-56-1 |
EINECS: | 209-940-8 |
Molecular Formula: | C4H11N |
Molecular Weight: | 73.14 |
InChI: | InChI=1/C4H11N/c1-4-5(2)3/h4H2,1-3H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2733 3 |
Density: | 0.675 |
Stability: | Stable. Extremely flammable - note low flash point. Incompatible with strong oxidizing agents. |
Refractive index: | 1.3715-1.3735 |
Water Solubility: | SOLUBLE |
Solubility: | Soluble in water,miscible with most common organic solven |
Appearance: | colorless liquid |
Packinggroup: | I |
HS Code: | 29211980 |
Storage Temperature: | Flammables area |
Color: | Liquid |
Usage: | As curing catalyst for resin bonding of sand cores. |
Safety Data |
Hazard Symbols |
F+:Highlyflammable
C:Corrosive
|
|
|