| Identification | |
| Name: | Propane,1,1,2-trichloro- |
| Synonyms: | 1,1,2-Trichloropropane |
| CAS: | 598-77-6 |
| EINECS: | 209-951-8 |
| Molecular Formula: | C3H5 Cl3 |
| Molecular Weight: | 147.43 |
| InChI: | InChI=1/C3H5Cl3/c1-2(4)3(5)6/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 44.3°C |
| Boiling Point: | 125.3°Cat760mmHg |
| Density: | 1.305g/cm3 |
| Refractive index: | 1.45 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 44.3°C |
| Safety Data | |
 |
|
