| Identification | |
| Name: | (+)-Limonene |
| Synonyms: | Limonene; 99%; Limonene 145; (R)-p-mentha-1,8-diene; (R)-(+)-Limonene; (R)-(+)-4-Isopropenyl-1-methylcyclohexene~(+)-p-Mentha-1,8-diene |
| CAS: | 5989-27-5 |
| EINECS: | 227-813-5 |
| Molecular Formula: | C10H16 |
| Molecular Weight: | 136.23 |
| InChI: | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2052 3 |
| Density: | 0.8405 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.473 |
| Alpha: | 112 o (10% IN ETHANOL) |
| Solubility: | In water, 13.8 mg/L at 25 deg C Miscible in ethanol and ether; soluble in carbon tetrachloride |
| Appearance: | clear almost colorless |
| Packinggroup: | III |
| Color: | Liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
 |
|
