| Identification | |
| Name: | D-Glucose monohydrate |
| Synonyms: | Dextrose monohydrate; Glucose; Corn sugar |
| CAS: | 5996-10-1 |
| EINECS: | 198.1712 |
| Molecular Formula: | C6H12O6?H2O |
| Molecular Weight: | 198.17 |
| InChI: | InChI=1/C6H12O6.H2O/c7-1-2-3(8)4(9)5(10)6(11)12-2;/h2-11H,1H2;1H2/t2-,3-,4-,5-,6+;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 83C (181F) |
| Solubility: | Stable under ordinary conditions of use and storage. < 50C the Hydrated crystalline form is |
| Appearance: | Colorless crystals or white crystalline powder |
| HS Code: | 17023051 |
| Safety Data | |
 |
|
