| Identification | |
| Name: | 3H-Pyrazol-3-one,1,2-dihydro-1,5-dimethyl-2-phenyl- |
| Synonyms: | Antipyrine(8CI);1,5-Dimethyl-2-phenyl-1,2-dihydropyrazol-3-one;2,3-Dimethyl-1-phenyl-3-pyrazolin-5-one;2,3-Dimethyl-1-phenyl-5-pyrazolone;Azophen;Azophene;Dentigoa N;Dimethyloxychinizin;Fenazone;Methozin;NSC7945;Oxydimethylquinazine;Parodyne;Phenazon;Phenazone;Phenazone(pharmaceutical);Phenylon;Phenylone;Pyrazophyl;Sedatin;Sedatine; |
| CAS: | 60-80-0 |
| EINECS: | 200-486-6 |
| Molecular Formula: | C11H12N2O |
| Molecular Weight: | 188.23 |
| InChI: | InChI=1/C11H12N2O/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3249 |
| Flash Point: | 109.4°C |
| Density: | 1.109g/cm3 |
| Stability: | Stable. Incompatible with ammonia, strong acids, alkalies, strong oxidizing agents, metallic salts, phenol. |
| Refractive index: | 1.553 |
| Solubility: | 1000 g/L (20 oC) |
| Appearance: | colourless crystals |
| Specification: | White Powder usageEng:Analgesic Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 109.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | Analgesic |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
