| Identification | |
| Name: | 1-Propanone,3-(4-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)- |
| Synonyms: | Phloretin(6CI);Propiophenone, 2',4',6'-trihydroxy-3-(p-hydroxyphenyl)- (8CI);2',4',6'-Trihydroxy-3-(4-Hydroxyphenyl)propiophenone;3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone;Dihydronaringenin;Floretin;NSC 407292;Naringenin dihydrochalcone;Phloretol;RJC 02792;b-(p-Hydroxyphenyl)-2,4,6-trihydroxypropiophenone;b-(p-Hydroxyphenyl)phloropropiophenone; |
| CAS: | 60-82-2 |
| EINECS: | 200-488-7 |
| Molecular Formula: | C15H14O5 |
| Molecular Weight: | 274.27 |
| InChI: | InChI=1/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.429 g/cm3 |
| Refractive index: | 1.572 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | Crystalline Solid |
| Specification: | Crystalline Solid usageEng:The aglucon of Phlorizin. A glucose transport inhibitor. Also inhibits protein kinase C and has been shown to inhibit the entry of five enveloped viruses into human fibroblasts. Safety Statements:37/39-26-36 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | 2-8°C |
| Usage: | The aglucon of Phlorizin. A glucose transport inhibitor. Also inhibits protein kinase C and has been shown to inhibit the entry of five enveloped viruses into human fibroblasts. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
