| Identification |
| Name: | Quinine dihydrochloride |
| Synonyms: | Cinchonan-9-ol,6'-methoxy-, dihydrochloride, (8a,9R)- (9CI);Quinine, dihydrochloride (8CI);(-)-Quinine dihydrochloride;Acid quinine hydrochloride;Quinine bimuriate;Cinchonan-9-ol,6'-methoxy-, hydrochloride (1:2), (8a,9R)-; |
| CAS: | 60-93-5 |
| EINECS: | 200-493-4 |
| Molecular Formula: | C20H26Cl2N2O2 |
| Molecular Weight: | 397.38 |
| InChI: | InChI=1/C20H24N2O2.2ClH/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;;/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;2*1H/t13-,14-,19-,20+;;/m0../s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 1544 |
| Stability: | Stable, but may be light sensitive. Efflorescent. Incompatible with strong oxidizing agents. |
| Appearance: | white solid |
| Specification: |
Quinine dihydrochloride , its cas register number is 60-93-5. It also can be called (-)-Quinine dihydrochloride ; Acid quinine hydrochloride ; Chinindihydrochlorid ; Quinine HCl ; Cinchonan-9-ol, 6'-methoxy-, dihydrochloride, (8-alpha,9R) (9CI) ; (6-Methoxy-4-quinolyl)(5-vinyl-1-azabicyclo[2.2.2]oct-2-yl)methanol dihydrochloride .It is a white solid.
|
| Packinggroup: | III |
| HS Code: | 29392000 |
| Usage: | Primary alkaloid of various species of Cinchona (Rubiaceae). Optical isomer of Quinidine. Antimalarial; muscle relaxant (skeletal) |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |