| Identification | |
| Name: | Propanoic acid, 2-oxo-,methyl ester |
| Synonyms: | Pyruvicacid, methyl ester (6CI,7CI,8CI);2-Oxo-propionic acid methyl ester;2-Oxopropanoic acid methyl ester;Methyl 2-oxopropanoate;Methyl2-oxopropionate;Methyl acetoformate;Methyl pyroracemate;Methyl pyruvate;Methylglyoxylic acid methyl ester;NSC 65430;Pyroracemic acid methyl ester; |
| CAS: | 600-22-6 |
| EINECS: | 209-987-4 |
| Molecular Formula: | C4H6O3 |
| Molecular Weight: | 102.08864 |
| InChI: | InChI=1S/C4H6O3/c1-3(5)4(6)7-2/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 199 |
| Density: | 1.13 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4065 |
| Water Solubility: | 10 (g/l) |
| Solubility: | 10 (g/l) |
| Appearance: | clear to yellow liquid |
| Specification: | CLEAR COLOURLESS TO YELLOW LIQUID Safety Statements:23-24/25-16 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| Color: | yellow cast |
| Safety Data | |
| Hazard Symbols |
3 (Packing Group: II)
UN
NO.
|
 |
|
