| Identification | |
| Name: | Ethyl p-iodobenzyl carbonate |
| Synonyms: | Ethyl p-iodobenzyl carbonate;CARBONIC ACID, ETHYL p-IODOBENZYL ESTER;BRN 2369936;Carbonic acid, ethyl (4-iodophenyl)methyl ester;60075-64-1;AC1L29CO;ethyl 4-iodobenzyl carbonate;ethyl (4-iodophenyl)methyl carbonate;LS-52043 |
| CAS: | 60075-64-1 |
| Molecular Formula: | C10H11IO3 |
| Molecular Weight: | 306.097 |
| InChI: | InChI=1/C10H11IO3/c1-2-13-10(12)14-7-8-3-5-9(11)6-4-8/h3-6H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 142.1°C |
| Boiling Point: | 311.3°C at 760 mmHg |
| Density: | 1.635g/cm3 |
| Refractive index: | 1.57 |
| Specification: |
Ethyl p-iodobenzyl carbonate , its cas register number is 60075-64-1. It also can be called BRN 2369936 ; Carbonic acid, ethyl (4-iodophenyl)methyl ester . When Ethyl p-iodobenzyl carbonate (CAS NO.60075-64-1) is heated to decomposition, it emits toxic vapors of I−. |
| Flash Point: | 142.1°C |
| Safety Data | |
 |
|
