| Identification | |
| Name: | 2-Propanamine,N-(1-methylethyl)-N-nitroso- |
| Synonyms: | Diethylamine,1,1'-dimethyl-N-nitroso- (6CI,7CI,8CI);Diisopropyl-N-nitrosamine;Diisopropylnitrosamine;N-Nitrosodiisopropylamine;NSC 336;Nitrosodiisopropylamine |
| CAS: | 601-77-4 |
| Molecular Formula: | C6H14 N2 O |
| Molecular Weight: | 130.22 |
| InChI: | InChI=1/C6H14N2O/c1-5(2)8(7-9)6(3)4/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 73.6°C |
| Boiling Point: | 194.5°C at 760 mmHg |
| Density: | 0.94g/cm3 |
| Refractive index: | 1.452 |
| Specification: | Off-White to Pale Yellow Solid usageEng:A nitroso compound that shows carcinogenic effect |
| Packinggroup: | III |
| Flash Point: | 73.6°C |
| Storage Temperature: | Refrigerator, Under Inert Atmosphere |
| Usage: |
A nitroso compound that shows carcinogenic effect. |
| Safety Data | |
 |
|
