| Identification | |
| Name: | tetrachlorothiophene |
| Synonyms: | - |
| CAS: | 6012-97-1 |
| EINECS: | 227-866-4 |
| Molecular Formula: | C4Cl4S |
| Molecular Weight: | 221.9198 |
| InChI: | InChI=1S/C4Cl4S/c5-1-2(6)4(8)9-3(1)7 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.704 |
| Refractive index: | 1.591 |
| Water Solubility: | Insoluble SOLVENT |
| Solubility: | Insoluble SOLVENT |
| Appearance: | yellow to yellowish liquid |
| Specification: |
2,3,4,5-Tetrachlorothiophene ,its CAS NO. is 6012-97-1,the synonyms is 2,3,4,5-Chlorothiophene ; 2,3,4,5-Tetrachloro-thiophen ; 2,3,4,5-Tetrachlorothiophene ; 2,3,4,5-Tetrachloro-thiophene ; Cp30487 ; ENT 25,764 ; Ent25,764;IF (Fumigant) . |
| Packinggroup: | III |
| Usage: | Solvent for organic reactions and spectral use. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
