| Identification | |
| Name: | Creatine monohydrate |
| Synonyms: | N-(Aminoiminomethyl)-N-methylglycine monohydrate;Glycine, N-(aminoiminomethyl)-N-methyl-, monohydrate;Creatine hydrate;2-(carbamimidoyl-methyl-amino)acetic acid hydrate;Creatine Mono;Creatine Monohydrate FCC 4;Creatine Monohydrate (P190);Creatine 1-hydrate; |
| CAS: | 6020-87-7 |
| EINECS: | 200-306-6 |
| Molecular Formula: | C4H9N3O2.H2O |
| Molecular Weight: | 149.15 |
| InChI: | InChI=1/C4H9N3O2.H2O/c1-7(4(5)6)2-3(8)9;/h2H2,1H3,(H3,5,6)(H,8,9);1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Appearance: | white cryst. powder |
| Specification: |
?Creatine monohydrate (CAS NO.6020-87-7) is also named as Creatine hydrate ; N-(Aminoiminomethyl)-N-methylglycine monohydrate?; Glycine, N-(aminoiminomethyl)-N-methyl-, monohydrate .?Creatine monohydrate (CAS NO.6020-87-7) is white cryst. powder. It is?slightly soluble in water, insoluble in alcohol and ether . |
| HS Code: | 29252000 |
| Storage Temperature: | Store at RT. |
| Usage: | Helps to supply energy to muscle and nerve cells. Often sold as a a performance-enhancing food supplement in sports. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
